About 2-[[7-(3,4-difluorophenyl)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide
2-[[7-(3,4-difluorophenyl)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide (PubChem CID 71181216) has the molecular formula C26H17F2N5O
and a molecular weight of 453.45 g/mol. Its IUPAC name is 2-[[7-(3,4-difluorophenyl)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide.
Molecular Properties
| Compound Name | 2-[[7-(3,4-difluorophenyl)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide |
| PubChem CID | 71181216 |
| Molecular Formula | C26H17F2N5O |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 2-[[7-(3,4-difluorophenyl)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1Nc1nc(-c2cccnc2)nc2cc(-c3ccc(F)c(F)c3)ccc12 |
| InChI | InChI=1S/C26H17F2N5O/c27-20-10-8-15(12-21(20)28)16-7-9-19-23(13-16)32-25(17-4-3-11-30-14-17)33-26(19)31-22-6-2-1-5-18(22)24(29)34/h1-14H,(H2,29,34)(H,31,32,33) |
| InChIKey | CCJDLBQOHJYOIU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[7-(3,4-difluorophenyl)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[7-(3,4-difluorophenyl)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide?
The IUPAC name of 2-[[7-(3,4-difluorophenyl)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide (CID 71181216) is 2-[[7-(3,4-difluorophenyl)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide.
What is the SMILES notation for 2-[[7-(3,4-difluorophenyl)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide?
The canonical SMILES for 2-[[7-(3,4-difluorophenyl)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide is NC(=O)c1ccccc1Nc1nc(-c2cccnc2)nc2cc(-c3ccc(F)c(F)c3)ccc12.
What is the InChIKey of 2-[[7-(3,4-difluorophenyl)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide?
The InChIKey is CCJDLBQOHJYOIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H17F2N5O/c27-20-10-8-15(12-21(20)28)16-7-9-19-23(13-16)32-25(17-4-3-11-30-14-17)33-26(19)31-22-6-2-1-5-18(22)24(29)34/h1-14H,(H2,29,34)(H,31,32,33).
What are the key properties of 2-[[7-(3,4-difluorophenyl)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide?
2-[[7-(3,4-difluorophenyl)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide has a molecular weight of 453.45 g/mol, XLogP of 5.48, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[7-(3,4-difluorophenyl)-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide is sourced from PubChem (CID 71181216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).