About (8R)-13,13-difluoro-8-[(3S)-3-(oxan-2-yloxy)butanoyl]-12-oxoheptadecanoic acid
(8R)-13,13-difluoro-8-[(3S)-3-(oxan-2-yloxy)butanoyl]-12-oxoheptadecanoic acid (PubChem CID 71181729) has the molecular formula C26H44F2O6
and a molecular weight of 490.63 g/mol. Its IUPAC name is (8R)-13,13-difluoro-8-[(3S)-3-(oxan-2-yloxy)butanoyl]-12-oxoheptadecanoic acid.
Molecular Properties
| Compound Name | (8R)-13,13-difluoro-8-[(3S)-3-(oxan-2-yloxy)butanoyl]-12-oxoheptadecanoic acid |
| PubChem CID | 71181729 |
| Molecular Formula | C26H44F2O6 |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | (8R)-13,13-difluoro-8-[(3S)-3-(oxan-2-yloxy)butanoyl]-12-oxoheptadecanoic acid |
| SMILES | CCCCC(F)(F)C(=O)CCC[C@@H](CCCCCCC(=O)O)C(=O)C[C@H](C)OC1CCCCO1 |
| InChI | InChI=1S/C26H44F2O6/c1-3-4-17-26(27,28)23(30)14-11-13-21(12-7-5-6-8-15-24(31)32)22(29)19-20(2)34-25-16-9-10-18-33-25/h20-21,25H,3-19H2,1-2H3,(H,31,32)/t20-,21+,25?/m0/s1 |
| InChIKey | ZTKGJSHUHCMROL-SXNCYPNXSA-N |
| XLogP | 6.48 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (8R)-13,13-difluoro-8-[(3S)-3-(oxan-2-yloxy)butanoyl]-12-oxoheptadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8R)-13,13-difluoro-8-[(3S)-3-(oxan-2-yloxy)butanoyl]-12-oxoheptadecanoic acid?
The IUPAC name of (8R)-13,13-difluoro-8-[(3S)-3-(oxan-2-yloxy)butanoyl]-12-oxoheptadecanoic acid (CID 71181729) is (8R)-13,13-difluoro-8-[(3S)-3-(oxan-2-yloxy)butanoyl]-12-oxoheptadecanoic acid.
What is the SMILES notation for (8R)-13,13-difluoro-8-[(3S)-3-(oxan-2-yloxy)butanoyl]-12-oxoheptadecanoic acid?
The canonical SMILES for (8R)-13,13-difluoro-8-[(3S)-3-(oxan-2-yloxy)butanoyl]-12-oxoheptadecanoic acid is CCCCC(F)(F)C(=O)CCC[C@@H](CCCCCCC(=O)O)C(=O)C[C@H](C)OC1CCCCO1.
What is the InChIKey of (8R)-13,13-difluoro-8-[(3S)-3-(oxan-2-yloxy)butanoyl]-12-oxoheptadecanoic acid?
The InChIKey is ZTKGJSHUHCMROL-SXNCYPNXSA-N. The full InChI is InChI=1S/C26H44F2O6/c1-3-4-17-26(27,28)23(30)14-11-13-21(12-7-5-6-8-15-24(31)32)22(29)19-20(2)34-25-16-9-10-18-33-25/h20-21,25H,3-19H2,1-2H3,(H,31,32)/t20-,21+,25?/m0/s1.
What are the key properties of (8R)-13,13-difluoro-8-[(3S)-3-(oxan-2-yloxy)butanoyl]-12-oxoheptadecanoic acid?
(8R)-13,13-difluoro-8-[(3S)-3-(oxan-2-yloxy)butanoyl]-12-oxoheptadecanoic acid has a molecular weight of 490.63 g/mol, XLogP of 6.48, 20 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (8R)-13,13-difluoro-8-[(3S)-3-(oxan-2-yloxy)butanoyl]-12-oxoheptadecanoic acid is sourced from PubChem (CID 71181729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).