C30H58O6Si — CID 71181796
7-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxycyclopentyl]heptanoic acid (PubChem CID 71181796) has the molecular formula C30H58O6Si and a molecular weight of 542.87 g/mol. Its IUPAC name is 7-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 71181796 |
| Molecular Formula | C30H58O6Si |
| Molecular Weight | 542.87 g/mol |
| Exact Mass | 542.40 |
| IUPAC Name | 7-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-hydroxycyclopentyl]heptanoic acid |
| SMILES | CCCCCCCC1(CC[C@H]2C(O[Si](C)(C)C(C)(C)C)CC(O)C2CCCCCCC(=O)O)OCCO1 |
| InChI | InChI=1S/C30H58O6Si/c1-7-8-9-12-15-19-30(34-21-22-35-30)20-18-25-24(16-13-10-11-14-17-28(32)33)26(31)23-27(25)36-37(5,6)29(2,3)4/h24-27,31H,7-23H2,1-6H3,(H,32,33)/t24?,25-,26?,27?/m1/s1 |
| InChIKey | NXAARJCOPXYMQQ-HCGFHUCKSA-N |
| XLogP | 7.68 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.87 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|