About 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-1-[(2-methylphenyl)methyl]quinolin-4-one
7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-1-[(2-methylphenyl)methyl]quinolin-4-one (PubChem CID 71182198) has the molecular formula C23H22N2O2
and a molecular weight of 358.44 g/mol. Its IUPAC name is 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-1-[(2-methylphenyl)methyl]quinolin-4-one.
Molecular Properties
| Compound Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-1-[(2-methylphenyl)methyl]quinolin-4-one |
| PubChem CID | 71182198 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-1-[(2-methylphenyl)methyl]quinolin-4-one |
| SMILES | Cc1ccccc1Cn1c(C)cc(=O)c2ccc(-c3c(C)noc3C)cc21 |
| InChI | InChI=1S/C23H22N2O2/c1-14-7-5-6-8-19(14)13-25-15(2)11-22(26)20-10-9-18(12-21(20)25)23-16(3)24-27-17(23)4/h5-12H,13H2,1-4H3 |
| InChIKey | FYYCWPFFURBFJT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-1-[(2-methylphenyl)methyl]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-1-[(2-methylphenyl)methyl]quinolin-4-one?
The IUPAC name of 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-1-[(2-methylphenyl)methyl]quinolin-4-one (CID 71182198) is 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-1-[(2-methylphenyl)methyl]quinolin-4-one.
What is the SMILES notation for 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-1-[(2-methylphenyl)methyl]quinolin-4-one?
The canonical SMILES for 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-1-[(2-methylphenyl)methyl]quinolin-4-one is Cc1ccccc1Cn1c(C)cc(=O)c2ccc(-c3c(C)noc3C)cc21.
What is the InChIKey of 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-1-[(2-methylphenyl)methyl]quinolin-4-one?
The InChIKey is FYYCWPFFURBFJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O2/c1-14-7-5-6-8-19(14)13-25-15(2)11-22(26)20-10-9-18(12-21(20)25)23-16(3)24-27-17(23)4/h5-12H,13H2,1-4H3.
What are the key properties of 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-1-[(2-methylphenyl)methyl]quinolin-4-one?
7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-1-[(2-methylphenyl)methyl]quinolin-4-one has a molecular weight of 358.44 g/mol, XLogP of 4.94, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methyl-1-[(2-methylphenyl)methyl]quinolin-4-one is sourced from PubChem (CID 71182198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).