C12H22O3S — CID 71182251
(3aS,4R,6aR)-4-(butoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole (PubChem CID 71182251) has the molecular formula C12H22O3S and a molecular weight of 246.37 g/mol. Its IUPAC name is (3aS,4R,6aR)-4-(butoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole.
| Compound Name | (3aS,4R,6aR)-4-(butoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 71182251 |
| Molecular Formula | C12H22O3S |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (3aS,4R,6aR)-4-(butoxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole |
| SMILES | CCCCOC[C@H]1SC[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C12H22O3S/c1-4-5-6-13-7-10-11-9(8-16-10)14-12(2,3)15-11/h9-11H,4-8H2,1-3H3/t9-,10+,11-/m0/s1 |
| InChIKey | GNBPIOVBYDNNIR-AXFHLTTASA-N |
| XLogP | 2.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|