About 2-[[(4R,5S)-6-ethyl-5-hydroxy-2-methoxy-4-methyloxan-3-yl]amino]-1-phenylethanone
2-[[(4R,5S)-6-ethyl-5-hydroxy-2-methoxy-4-methyloxan-3-yl]amino]-1-phenylethanone (PubChem CID 71182584) has the molecular formula C17H25NO4
and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-[[(4R,5S)-6-ethyl-5-hydroxy-2-methoxy-4-methyloxan-3-yl]amino]-1-phenylethanone.
Molecular Properties
| Compound Name | 2-[[(4R,5S)-6-ethyl-5-hydroxy-2-methoxy-4-methyloxan-3-yl]amino]-1-phenylethanone |
| PubChem CID | 71182584 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 2-[[(4R,5S)-6-ethyl-5-hydroxy-2-methoxy-4-methyloxan-3-yl]amino]-1-phenylethanone |
| SMILES | CCC1OC(OC)C(NCC(=O)c2ccccc2)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C17H25NO4/c1-4-14-16(20)11(2)15(17(21-3)22-14)18-10-13(19)12-8-6-5-7-9-12/h5-9,11,14-18,20H,4,10H2,1-3H3/t11-,14?,15?,16+,17?/m1/s1 |
| InChIKey | ZAQZJZXGMNQYEU-BNVHZMNASA-N |
| XLogP | 1.61 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(4R,5S)-6-ethyl-5-hydroxy-2-methoxy-4-methyloxan-3-yl]amino]-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(4R,5S)-6-ethyl-5-hydroxy-2-methoxy-4-methyloxan-3-yl]amino]-1-phenylethanone?
The IUPAC name of 2-[[(4R,5S)-6-ethyl-5-hydroxy-2-methoxy-4-methyloxan-3-yl]amino]-1-phenylethanone (CID 71182584) is 2-[[(4R,5S)-6-ethyl-5-hydroxy-2-methoxy-4-methyloxan-3-yl]amino]-1-phenylethanone.
What is the SMILES notation for 2-[[(4R,5S)-6-ethyl-5-hydroxy-2-methoxy-4-methyloxan-3-yl]amino]-1-phenylethanone?
The canonical SMILES for 2-[[(4R,5S)-6-ethyl-5-hydroxy-2-methoxy-4-methyloxan-3-yl]amino]-1-phenylethanone is CCC1OC(OC)C(NCC(=O)c2ccccc2)[C@@H](C)[C@@H]1O.
What is the InChIKey of 2-[[(4R,5S)-6-ethyl-5-hydroxy-2-methoxy-4-methyloxan-3-yl]amino]-1-phenylethanone?
The InChIKey is ZAQZJZXGMNQYEU-BNVHZMNASA-N. The full InChI is InChI=1S/C17H25NO4/c1-4-14-16(20)11(2)15(17(21-3)22-14)18-10-13(19)12-8-6-5-7-9-12/h5-9,11,14-18,20H,4,10H2,1-3H3/t11-,14?,15?,16+,17?/m1/s1.
What are the key properties of 2-[[(4R,5S)-6-ethyl-5-hydroxy-2-methoxy-4-methyloxan-3-yl]amino]-1-phenylethanone?
2-[[(4R,5S)-6-ethyl-5-hydroxy-2-methoxy-4-methyloxan-3-yl]amino]-1-phenylethanone has a molecular weight of 307.39 g/mol, XLogP of 1.61, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(4R,5S)-6-ethyl-5-hydroxy-2-methoxy-4-methyloxan-3-yl]amino]-1-phenylethanone is sourced from PubChem (CID 71182584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).