C22H20F3N3O5S — CID 71183075
2-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-8-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide (PubChem CID 71183075) has the molecular formula C22H20F3N3O5S and a molecular weight of 495.48 g/mol. Its IUPAC name is 2-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-8-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide.
| Compound Name | 2-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-8-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 71183075 |
| Molecular Formula | C22H20F3N3O5S |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 2-[(5-cyclobutyl-1,3,4-oxadiazol-2-yl)methyl]-8-[4-(trifluoromethoxy)phenyl]-3,4-dihydro-5,1λ6,2-benzoxathiazepine 1,1-dioxide |
| SMILES | O=S1(=O)c2cc(-c3ccc(OC(F)(F)F)cc3)ccc2OCCN1Cc1nnc(C2CCC2)o1 |
| InChI | InChI=1S/C22H20F3N3O5S/c23-22(24,25)33-17-7-4-14(5-8-17)16-6-9-18-19(12-16)34(29,30)28(10-11-31-18)13-20-26-27-21(32-20)15-2-1-3-15/h4-9,12,15H,1-3,10-11,13H2 |
| InChIKey | BHNAFXABFIFBNN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |