C19H25FN4O — CID 71183494
1-[4-[3-[(1S)-1-aminoethyl]-7-fluoro-8-methylquinolin-2-yl]piperazin-1-yl]propan-1-one (PubChem CID 71183494) has the molecular formula C19H25FN4O and a molecular weight of 344.43 g/mol. Its IUPAC name is 1-[4-[3-[(1S)-1-aminoethyl]-7-fluoro-8-methylquinolin-2-yl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[3-[(1S)-1-aminoethyl]-7-fluoro-8-methylquinolin-2-yl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 71183494 |
| Molecular Formula | C19H25FN4O |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 1-[4-[3-[(1S)-1-aminoethyl]-7-fluoro-8-methylquinolin-2-yl]piperazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(c2nc3c(C)c(F)ccc3cc2[C@H](C)N)CC1 |
| InChI | InChI=1S/C19H25FN4O/c1-4-17(25)23-7-9-24(10-8-23)19-15(13(3)21)11-14-5-6-16(20)12(2)18(14)22-19/h5-6,11,13H,4,7-10,21H2,1-3H3/t13-/m0/s1 |
| InChIKey | HZNNFOYTKQCMGM-ZDUSSCGKSA-N |
| XLogP | 2.76 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |