C24H17F3N6O2S — CID 71183718
5-(3-methylsulfonylphenyl)-2-[7-[(2,3,4-trifluorophenyl)methyl]imidazo[1,5-b]pyridazin-5-yl]pyrimidin-4-amine (PubChem CID 71183718) has the molecular formula C24H17F3N6O2S and a molecular weight of 510.50 g/mol. Its IUPAC name is 5-(3-methylsulfonylphenyl)-2-[7-[(2,3,4-trifluorophenyl)methyl]imidazo[1,5-b]pyridazin-5-yl]pyrimidin-4-amine.
| Compound Name | 5-(3-methylsulfonylphenyl)-2-[7-[(2,3,4-trifluorophenyl)methyl]imidazo[1,5-b]pyridazin-5-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 71183718 |
| Molecular Formula | C24H17F3N6O2S |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 5-(3-methylsulfonylphenyl)-2-[7-[(2,3,4-trifluorophenyl)methyl]imidazo[1,5-b]pyridazin-5-yl]pyrimidin-4-amine |
| SMILES | CS(=O)(=O)c1cccc(-c2cnc(-c3nc(Cc4ccc(F)c(F)c4F)n4ncccc34)nc2N)c1 |
| InChI | InChI=1S/C24H17F3N6O2S/c1-36(34,35)15-5-2-4-13(10-15)16-12-29-24(32-23(16)28)22-18-6-3-9-30-33(18)19(31-22)11-14-7-8-17(25)21(27)20(14)26/h2-10,12H,11H2,1H3,(H2,28,29,32) |
| InChIKey | CHUJLLCGJWDAOH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|