C20H14F3N5O2 — CID 71183907
[pyrimidin-5-yl-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]methyl]carbamic acid (PubChem CID 71183907) has the molecular formula C20H14F3N5O2 and a molecular weight of 413.36 g/mol. Its IUPAC name is [pyrimidin-5-yl-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]methyl]carbamic acid.
| Compound Name | [pyrimidin-5-yl-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 71183907 |
| Molecular Formula | C20H14F3N5O2 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [pyrimidin-5-yl-[3-[(2,3,6-trifluorophenyl)methyl]indazol-1-yl]methyl]carbamic acid |
| SMILES | O=C(O)NC(c1cncnc1)n1nc(Cc2c(F)ccc(F)c2F)c2ccccc21 |
| InChI | InChI=1S/C20H14F3N5O2/c21-14-5-6-15(22)18(23)13(14)7-16-12-3-1-2-4-17(12)28(27-16)19(26-20(29)30)11-8-24-10-25-9-11/h1-6,8-10,19,26H,7H2,(H,29,30) |
| InChIKey | ZZLLXQIJCOIBSR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|