About [4-methoxy-1-(2,4,5-trifluorophenyl)cyclohexyl]methanamine
[4-methoxy-1-(2,4,5-trifluorophenyl)cyclohexyl]methanamine (PubChem CID 71184623) has the molecular formula C14H18F3NO
and a molecular weight of 273.30 g/mol. Its IUPAC name is [4-methoxy-1-(2,4,5-trifluorophenyl)cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [4-methoxy-1-(2,4,5-trifluorophenyl)cyclohexyl]methanamine |
| PubChem CID | 71184623 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | [4-methoxy-1-(2,4,5-trifluorophenyl)cyclohexyl]methanamine |
| SMILES | COC1CCC(CN)(c2cc(F)c(F)cc2F)CC1 |
| InChI | InChI=1S/C14H18F3NO/c1-19-9-2-4-14(8-18,5-3-9)10-6-12(16)13(17)7-11(10)15/h6-7,9H,2-5,8,18H2,1H3 |
| InChIKey | WVFIEHIICOKQME-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [4-methoxy-1-(2,4,5-trifluorophenyl)cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methoxy-1-(2,4,5-trifluorophenyl)cyclohexyl]methanamine?
The IUPAC name of [4-methoxy-1-(2,4,5-trifluorophenyl)cyclohexyl]methanamine (CID 71184623) is [4-methoxy-1-(2,4,5-trifluorophenyl)cyclohexyl]methanamine.
What is the SMILES notation for [4-methoxy-1-(2,4,5-trifluorophenyl)cyclohexyl]methanamine?
The canonical SMILES for [4-methoxy-1-(2,4,5-trifluorophenyl)cyclohexyl]methanamine is COC1CCC(CN)(c2cc(F)c(F)cc2F)CC1.
What is the InChIKey of [4-methoxy-1-(2,4,5-trifluorophenyl)cyclohexyl]methanamine?
The InChIKey is WVFIEHIICOKQME-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F3NO/c1-19-9-2-4-14(8-18,5-3-9)10-6-12(16)13(17)7-11(10)15/h6-7,9H,2-5,8,18H2,1H3.
What are the key properties of [4-methoxy-1-(2,4,5-trifluorophenyl)cyclohexyl]methanamine?
[4-methoxy-1-(2,4,5-trifluorophenyl)cyclohexyl]methanamine has a molecular weight of 273.30 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methoxy-1-(2,4,5-trifluorophenyl)cyclohexyl]methanamine is sourced from PubChem (CID 71184623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).