C28H23F2N3O2 — CID 71184999
3-[2-[2-(3,5-difluorophenyl)-2-[(2-phenylacetyl)amino]ethyl]-3-pyridinyl]benzamide (PubChem CID 71184999) has the molecular formula C28H23F2N3O2 and a molecular weight of 471.51 g/mol. Its IUPAC name is 3-[2-[2-(3,5-difluorophenyl)-2-[(2-phenylacetyl)amino]ethyl]-3-pyridinyl]benzamide.
| Compound Name | 3-[2-[2-(3,5-difluorophenyl)-2-[(2-phenylacetyl)amino]ethyl]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 71184999 |
| Molecular Formula | C28H23F2N3O2 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 3-[2-[2-(3,5-difluorophenyl)-2-[(2-phenylacetyl)amino]ethyl]-3-pyridinyl]benzamide |
| SMILES | NC(=O)c1cccc(-c2cccnc2CC(NC(=O)Cc2ccccc2)c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C28H23F2N3O2/c29-22-14-21(15-23(30)16-22)25(33-27(34)12-18-6-2-1-3-7-18)17-26-24(10-5-11-32-26)19-8-4-9-20(13-19)28(31)35/h1-11,13-16,25H,12,17H2,(H2,31,35)(H,33,34) |
| InChIKey | AHSOQFYCRGFPDW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |