C36H31F5N6O3 — CID 71185014
5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[3-[difluoro(pyridin-2-ylmethoxy)methyl]-4,5,6,7-tetrahydroindazol-2-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 71185014) has the molecular formula C36H31F5N6O3 and a molecular weight of 690.67 g/mol. Its IUPAC name is 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[3-[difluoro(pyridin-2-ylmethoxy)methyl]-4,5,6,7-tetrahydroindazol-2-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[3-[difluoro(pyridin-2-ylmethoxy)methyl]-4,5,6,7-tetrahydroindazol-2-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 71185014 |
| Molecular Formula | C36H31F5N6O3 |
| Molecular Weight | 690.67 g/mol |
| Exact Mass | 690.24 |
| IUPAC Name | 5-[2-[(1S)-2-(3,5-difluorophenyl)-1-[[2-[3-[difluoro(pyridin-2-ylmethoxy)methyl]-4,5,6,7-tetrahydroindazol-2-yl]acetyl]amino]ethyl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2cccnc2[C@H](Cc2cc(F)cc(F)c2)NC(=O)Cn2nc3c(c2C(F)(F)OCc2ccccn2)CCCC3)ccc1F |
| InChI | InChI=1S/C36H31F5N6O3/c37-23-14-21(15-24(38)18-23)16-31(33-26(8-5-13-44-33)22-10-11-29(39)28(17-22)35(42)49)45-32(48)19-47-34(27-7-1-2-9-30(27)46-47)36(40,41)50-20-25-6-3-4-12-43-25/h3-6,8,10-15,17-18,31H,1-2,7,9,16,19-20H2,(H2,42,49)(H,45,48)/t31-/m0/s1 |
| InChIKey | WYJHXIRKAIZVAZ-HKBQPEDESA-N |
| XLogP | 6.10 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.67 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |