C33H30F5N5O2 — CID 71185061
N-cyclopropyl-3-[2-[2-(3,5-difluorophenyl)-2-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]benzamide (PubChem CID 71185061) has the molecular formula C33H30F5N5O2 and a molecular weight of 623.63 g/mol. Its IUPAC name is N-cyclopropyl-3-[2-[2-(3,5-difluorophenyl)-2-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]benzamide.
| Compound Name | N-cyclopropyl-3-[2-[2-(3,5-difluorophenyl)-2-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 71185061 |
| Molecular Formula | C33H30F5N5O2 |
| Molecular Weight | 623.63 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | N-cyclopropyl-3-[2-[2-(3,5-difluorophenyl)-2-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]benzamide |
| SMILES | O=C(Cn1nc(C(F)(F)F)c2c1CCCC2)NC(Cc1ncccc1-c1cccc(C(=O)NC2CC2)c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C33H30F5N5O2/c34-22-14-21(15-23(35)16-22)27(41-30(44)18-43-29-9-2-1-7-26(29)31(42-43)33(36,37)38)17-28-25(8-4-12-39-28)19-5-3-6-20(13-19)32(45)40-24-10-11-24/h3-6,8,12-16,24,27H,1-2,7,9-11,17-18H2,(H,40,45)(H,41,44) |
| InChIKey | FTJYMORLIQEZHE-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |