About [5-(1-benzofuran-2-yl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone
[5-(1-benzofuran-2-yl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone (PubChem CID 71185252) has the molecular formula C18H13FN2O2
and a molecular weight of 308.31 g/mol. Its IUPAC name is [5-(1-benzofuran-2-yl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone.
Molecular Properties
| Compound Name | [5-(1-benzofuran-2-yl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone |
| PubChem CID | 71185252 |
| Molecular Formula | C18H13FN2O2 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | [5-(1-benzofuran-2-yl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone |
| SMILES | O=C(c1cccc(F)c1)N1CCC(c2cc3ccccc3o2)=N1 |
| InChI | InChI=1S/C18H13FN2O2/c19-14-6-3-5-13(10-14)18(22)21-9-8-15(20-21)17-11-12-4-1-2-7-16(12)23-17/h1-7,10-11H,8-9H2 |
| InChIKey | GTFCRQDBUSIRPA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(1-benzofuran-2-yl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1-benzofuran-2-yl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone?
The IUPAC name of [5-(1-benzofuran-2-yl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone (CID 71185252) is [5-(1-benzofuran-2-yl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone.
What is the SMILES notation for [5-(1-benzofuran-2-yl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone?
The canonical SMILES for [5-(1-benzofuran-2-yl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone is O=C(c1cccc(F)c1)N1CCC(c2cc3ccccc3o2)=N1.
What is the InChIKey of [5-(1-benzofuran-2-yl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone?
The InChIKey is GTFCRQDBUSIRPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13FN2O2/c19-14-6-3-5-13(10-14)18(22)21-9-8-15(20-21)17-11-12-4-1-2-7-16(12)23-17/h1-7,10-11H,8-9H2.
What are the key properties of [5-(1-benzofuran-2-yl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone?
[5-(1-benzofuran-2-yl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone has a molecular weight of 308.31 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1-benzofuran-2-yl)-3,4-dihydropyrazol-2-yl]-(3-fluorophenyl)methanone is sourced from PubChem (CID 71185252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).