About tert-butyl N-[(2S)-2-(3,5-difluorophenyl)-2-(5-isoquinolin-6-ylpyrimidin-4-yl)ethyl]carbamate
tert-butyl N-[(2S)-2-(3,5-difluorophenyl)-2-(5-isoquinolin-6-ylpyrimidin-4-yl)ethyl]carbamate (PubChem CID 71185344) has the molecular formula C26H24F2N4O2
and a molecular weight of 462.50 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-(3,5-difluorophenyl)-2-(5-isoquinolin-6-ylpyrimidin-4-yl)ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2S)-2-(3,5-difluorophenyl)-2-(5-isoquinolin-6-ylpyrimidin-4-yl)ethyl]carbamate |
| PubChem CID | 71185344 |
| Molecular Formula | C26H24F2N4O2 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | tert-butyl N-[(2S)-2-(3,5-difluorophenyl)-2-(5-isoquinolin-6-ylpyrimidin-4-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@H](c1cc(F)cc(F)c1)c1ncncc1-c1ccc2cnccc2c1 |
| InChI | InChI=1S/C26H24F2N4O2/c1-26(2,3)34-25(33)31-14-23(19-9-20(27)11-21(28)10-19)24-22(13-30-15-32-24)17-4-5-18-12-29-7-6-16(18)8-17/h4-13,15,23H,14H2,1-3H3,(H,31,33)/t23-/m1/s1 |
| InChIKey | JZTWZCUPLZAPEM-HSZRJFAPSA-N |
| XLogP | 5.63 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[(2S)-2-(3,5-difluorophenyl)-2-(5-isoquinolin-6-ylpyrimidin-4-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2S)-2-(3,5-difluorophenyl)-2-(5-isoquinolin-6-ylpyrimidin-4-yl)ethyl]carbamate?
The IUPAC name of tert-butyl N-[(2S)-2-(3,5-difluorophenyl)-2-(5-isoquinolin-6-ylpyrimidin-4-yl)ethyl]carbamate (CID 71185344) is tert-butyl N-[(2S)-2-(3,5-difluorophenyl)-2-(5-isoquinolin-6-ylpyrimidin-4-yl)ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[(2S)-2-(3,5-difluorophenyl)-2-(5-isoquinolin-6-ylpyrimidin-4-yl)ethyl]carbamate?
The canonical SMILES for tert-butyl N-[(2S)-2-(3,5-difluorophenyl)-2-(5-isoquinolin-6-ylpyrimidin-4-yl)ethyl]carbamate is CC(C)(C)OC(=O)NC[C@H](c1cc(F)cc(F)c1)c1ncncc1-c1ccc2cnccc2c1.
What is the InChIKey of tert-butyl N-[(2S)-2-(3,5-difluorophenyl)-2-(5-isoquinolin-6-ylpyrimidin-4-yl)ethyl]carbamate?
The InChIKey is JZTWZCUPLZAPEM-HSZRJFAPSA-N. The full InChI is InChI=1S/C26H24F2N4O2/c1-26(2,3)34-25(33)31-14-23(19-9-20(27)11-21(28)10-19)24-22(13-30-15-32-24)17-4-5-18-12-29-7-6-16(18)8-17/h4-13,15,23H,14H2,1-3H3,(H,31,33)/t23-/m1/s1.
What are the key properties of tert-butyl N-[(2S)-2-(3,5-difluorophenyl)-2-(5-isoquinolin-6-ylpyrimidin-4-yl)ethyl]carbamate?
tert-butyl N-[(2S)-2-(3,5-difluorophenyl)-2-(5-isoquinolin-6-ylpyrimidin-4-yl)ethyl]carbamate has a molecular weight of 462.50 g/mol, XLogP of 5.63, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2S)-2-(3,5-difluorophenyl)-2-(5-isoquinolin-6-ylpyrimidin-4-yl)ethyl]carbamate is sourced from PubChem (CID 71185344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).