C29H40N4O3 — CID 71185589
(2R)-N-[(2S)-1-[[4-(aminomethyl)phenyl]methylamino]-1-oxo-3-phenylpropan-2-yl]-3-cyclohexyl-2-(propanoylamino)propanamide (PubChem CID 71185589) has the molecular formula C29H40N4O3 and a molecular weight of 492.66 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-[[4-(aminomethyl)phenyl]methylamino]-1-oxo-3-phenylpropan-2-yl]-3-cyclohexyl-2-(propanoylamino)propanamide.
| Compound Name | (2R)-N-[(2S)-1-[[4-(aminomethyl)phenyl]methylamino]-1-oxo-3-phenylpropan-2-yl]-3-cyclohexyl-2-(propanoylamino)propanamide |
|---|---|
| PubChem CID | 71185589 |
| Molecular Formula | C29H40N4O3 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | (2R)-N-[(2S)-1-[[4-(aminomethyl)phenyl]methylamino]-1-oxo-3-phenylpropan-2-yl]-3-cyclohexyl-2-(propanoylamino)propanamide |
| SMILES | CCC(=O)N[C@H](CC1CCCCC1)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCc1ccc(CN)cc1 |
| InChI | InChI=1S/C29H40N4O3/c1-2-27(34)32-26(18-22-11-7-4-8-12-22)29(36)33-25(17-21-9-5-3-6-10-21)28(35)31-20-24-15-13-23(19-30)14-16-24/h3,5-6,9-10,13-16,22,25-26H,2,4,7-8,11-12,17-20,30H2,1H3,(H,31,35)(H,32,34)(H,33,36)/t25-,26+/m0/s1 |
| InChIKey | QLIXNVHPGDHCMQ-IZZNHLLZSA-N |
| XLogP | 3.35 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |