C11H18N4O2Si — CID 71186443
3-(2-trimethylsilylethoxymethyl)-5,7-dihydropyrrolo[2,3-e][1,2,4]triazin-6-one (PubChem CID 71186443) has the molecular formula C11H18N4O2Si and a molecular weight of 266.38 g/mol. Its IUPAC name is 3-(2-trimethylsilylethoxymethyl)-5,7-dihydropyrrolo[2,3-e][1,2,4]triazin-6-one.
| Compound Name | 3-(2-trimethylsilylethoxymethyl)-5,7-dihydropyrrolo[2,3-e][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 71186443 |
| Molecular Formula | C11H18N4O2Si |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-(2-trimethylsilylethoxymethyl)-5,7-dihydropyrrolo[2,3-e][1,2,4]triazin-6-one |
| SMILES | C[Si](C)(C)CCOCc1nnc2c(n1)NC(=O)C2 |
| InChI | InChI=1S/C11H18N4O2Si/c1-18(2,3)5-4-17-7-9-12-11-8(14-15-9)6-10(16)13-11/h4-7H2,1-3H3,(H,12,13,15,16) |
| InChIKey | MMPXFLQKSQRVHM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|