About 4,5-dithiophen-2-yl-2,1,3-benzothiadiazole
4,5-dithiophen-2-yl-2,1,3-benzothiadiazole (PubChem CID 71186474) has the molecular formula C14H8N2S3
and a molecular weight of 300.43 g/mol. Its IUPAC name is 4,5-dithiophen-2-yl-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | 4,5-dithiophen-2-yl-2,1,3-benzothiadiazole |
| PubChem CID | 71186474 |
| Molecular Formula | C14H8N2S3 |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 4,5-dithiophen-2-yl-2,1,3-benzothiadiazole |
| SMILES | c1csc(-c2ccc3nsnc3c2-c2cccs2)c1 |
| InChI | InChI=1S/C14H8N2S3/c1-3-11(17-7-1)9-5-6-10-14(16-19-15-10)13(9)12-4-2-8-18-12/h1-8H |
| InChIKey | JEUYTZKVCAQKCV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dithiophen-2-yl-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dithiophen-2-yl-2,1,3-benzothiadiazole?
The IUPAC name of 4,5-dithiophen-2-yl-2,1,3-benzothiadiazole (CID 71186474) is 4,5-dithiophen-2-yl-2,1,3-benzothiadiazole.
What is the SMILES notation for 4,5-dithiophen-2-yl-2,1,3-benzothiadiazole?
The canonical SMILES for 4,5-dithiophen-2-yl-2,1,3-benzothiadiazole is c1csc(-c2ccc3nsnc3c2-c2cccs2)c1.
What is the InChIKey of 4,5-dithiophen-2-yl-2,1,3-benzothiadiazole?
The InChIKey is JEUYTZKVCAQKCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2S3/c1-3-11(17-7-1)9-5-6-10-14(16-19-15-10)13(9)12-4-2-8-18-12/h1-8H.
What are the key properties of 4,5-dithiophen-2-yl-2,1,3-benzothiadiazole?
4,5-dithiophen-2-yl-2,1,3-benzothiadiazole has a molecular weight of 300.43 g/mol, XLogP of 5.15, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dithiophen-2-yl-2,1,3-benzothiadiazole is sourced from PubChem (CID 71186474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).