C32H31F5N4O2 — CID 71186726
N-[2-(3,5-difluorophenyl)-1-[3-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]ethyl]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetamide (PubChem CID 71186726) has the molecular formula C32H31F5N4O2 and a molecular weight of 598.62 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)-1-[3-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]ethyl]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetamide.
| Compound Name | N-[2-(3,5-difluorophenyl)-1-[3-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]ethyl]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetamide |
|---|---|
| PubChem CID | 71186726 |
| Molecular Formula | C32H31F5N4O2 |
| Molecular Weight | 598.62 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)-1-[3-(4-methoxy-2,6-dimethylphenyl)-2-pyridinyl]ethyl]-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetamide |
| SMILES | COc1cc(C)c(-c2cccnc2C(Cc2cc(F)cc(F)c2)NC(=O)Cn2nc(C(F)(F)F)c3c2CCCC3)c(C)c1 |
| InChI | InChI=1S/C32H31F5N4O2/c1-18-11-23(43-3)12-19(2)29(18)25-8-6-10-38-30(25)26(15-20-13-21(33)16-22(34)14-20)39-28(42)17-41-27-9-5-4-7-24(27)31(40-41)32(35,36)37/h6,8,10-14,16,26H,4-5,7,9,15,17H2,1-3H3,(H,39,42) |
| InChIKey | FSXYBKBPAWNQRW-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.62 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |