C31H26F5N5O2 — CID 71186815
5-[2-[(1S)-1-[[2-[5-(difluoromethyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-3-yl]acetyl]amino]-2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 71186815) has the molecular formula C31H26F5N5O2 and a molecular weight of 595.57 g/mol. Its IUPAC name is 5-[2-[(1S)-1-[[2-[5-(difluoromethyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-3-yl]acetyl]amino]-2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(1S)-1-[[2-[5-(difluoromethyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-3-yl]acetyl]amino]-2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 71186815 |
| Molecular Formula | C31H26F5N5O2 |
| Molecular Weight | 595.57 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | 5-[2-[(1S)-1-[[2-[5-(difluoromethyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-3-yl]acetyl]amino]-2-(3,5-difluorophenyl)ethyl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2cccnc2[C@H](Cc2cc(F)cc(F)c2)NC(=O)Cn2nc(C(F)F)c3c2C2CCC3C2)ccc1F |
| InChI | InChI=1S/C31H26F5N5O2/c32-19-8-15(9-20(33)13-19)10-24(27-21(2-1-7-38-27)16-5-6-23(34)22(12-16)31(37)43)39-25(42)14-41-29-18-4-3-17(11-18)26(29)28(40-41)30(35)36/h1-2,5-9,12-13,17-18,24,30H,3-4,10-11,14H2,(H2,37,43)(H,39,42)/t17?,18?,24-/m0/s1 |
| InChIKey | JXHVVZXDPDIKIY-XCNDVJPKSA-N |
| XLogP | 5.86 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.57 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |