C17H14F2N6OS — CID 71187087
[4-[4-amino-7-[2-(aminomethyl)-1,3-thiazol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2,6-difluorophenyl]methanol (PubChem CID 71187087) has the molecular formula C17H14F2N6OS and a molecular weight of 388.40 g/mol. Its IUPAC name is [4-[4-amino-7-[2-(aminomethyl)-1,3-thiazol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2,6-difluorophenyl]methanol.
| Compound Name | [4-[4-amino-7-[2-(aminomethyl)-1,3-thiazol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2,6-difluorophenyl]methanol |
|---|---|
| PubChem CID | 71187087 |
| Molecular Formula | C17H14F2N6OS |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | [4-[4-amino-7-[2-(aminomethyl)-1,3-thiazol-4-yl]pyrrolo[2,1-f][1,2,4]triazin-5-yl]-2,6-difluorophenyl]methanol |
| SMILES | NCc1nc(-c2cc(-c3cc(F)c(CO)c(F)c3)c3c(N)ncnn23)cs1 |
| InChI | InChI=1S/C17H14F2N6OS/c18-11-1-8(2-12(19)10(11)5-26)9-3-14(13-6-27-15(4-20)24-13)25-16(9)17(21)22-7-23-25/h1-3,6-7,26H,4-5,20H2,(H2,21,22,23) |
| InChIKey | FWVKKGSYAGNETL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |