C34H35F5N6O2 — CID 71187137
3-[2-[2-(3,5-difluorophenyl)-1-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 71187137) has the molecular formula C34H35F5N6O2 and a molecular weight of 654.68 g/mol. Its IUPAC name is 3-[2-[2-(3,5-difluorophenyl)-1-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 3-[2-[2-(3,5-difluorophenyl)-1-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 71187137 |
| Molecular Formula | C34H35F5N6O2 |
| Molecular Weight | 654.68 g/mol |
| Exact Mass | 654.27 |
| IUPAC Name | 3-[2-[2-(3,5-difluorophenyl)-1-[[2-[3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]acetyl]amino]ethyl]-3-pyridinyl]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CN(C)CCNC(=O)c1cccc(-c2cccnc2C(Cc2cc(F)cc(F)c2)NC(=O)Cn2nc(C(F)(F)F)c3c2CCCC3)c1 |
| InChI | InChI=1S/C34H35F5N6O2/c1-44(2)14-13-41-33(47)23-8-5-7-22(18-23)26-10-6-12-40-31(26)28(17-21-15-24(35)19-25(36)16-21)42-30(46)20-45-29-11-4-3-9-27(29)32(43-45)34(37,38)39/h5-8,10,12,15-16,18-19,28H,3-4,9,11,13-14,17,20H2,1-2H3,(H,41,47)(H,42,46) |
| InChIKey | JWBMPVGEZHTOKV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.68 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |