C40H53F3N8S2 — CID 71187155
5-[4-(2-cyclohexylethyl)piperazin-1-yl]-3-(3,4-difluorophenyl)-1,2,4-thiadiazole;5-[4-(2-cyclohexylethyl)piperazin-1-yl]-3-(3-fluorophenyl)-1,2,4-thiadiazole (PubChem CID 71187155) has the molecular formula C40H53F3N8S2 and a molecular weight of 767.05 g/mol. Its IUPAC name is 5-[4-(2-cyclohexylethyl)piperazin-1-yl]-3-(3,4-difluorophenyl)-1,2,4-thiadiazole;5-[4-(2-cyclohexylethyl)piperazin-1-yl]-3-(3-fluorophenyl)-1,2,4-thiadiazole.
| Compound Name | 5-[4-(2-cyclohexylethyl)piperazin-1-yl]-3-(3,4-difluorophenyl)-1,2,4-thiadiazole;5-[4-(2-cyclohexylethyl)piperazin-1-yl]-3-(3-fluorophenyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 71187155 |
| Molecular Formula | C40H53F3N8S2 |
| Molecular Weight | 767.05 g/mol |
| Exact Mass | 766.38 |
| IUPAC Name | 5-[4-(2-cyclohexylethyl)piperazin-1-yl]-3-(3,4-difluorophenyl)-1,2,4-thiadiazole;5-[4-(2-cyclohexylethyl)piperazin-1-yl]-3-(3-fluorophenyl)-1,2,4-thiadiazole |
| SMILES | Fc1ccc(-c2nsc(N3CCN(CCC4CCCCC4)CC3)n2)cc1F.Fc1cccc(-c2nsc(N3CCN(CCC4CCCCC4)CC3)n2)c1 |
| InChI | InChI=1S/C20H26F2N4S.C20H27FN4S/c21-17-7-6-16(14-18(17)22)19-23-20(27-24-19)26-12-10-25(11-13-26)9-8-15-4-2-1-3-5-15;21-18-8-4-7-17(15-18)19-22-20(26-23-19)25-13-11-24(12-14-25)10-9-16-5-2-1-3-6-16/h6-7,14-15H,1-5,8-13H2;4,7-8,15-16H,1-3,5-6,9-14H2 |
| InChIKey | GGIFZDHRCJSQLZ-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 64.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.05 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |