C13H13NO2S — CID 71187230
3-hydroxy-5-[(4-methylphenyl)methylsulfanyl]-1H-pyridin-2-one (PubChem CID 71187230) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is 3-hydroxy-5-[(4-methylphenyl)methylsulfanyl]-1H-pyridin-2-one.
| Compound Name | 3-hydroxy-5-[(4-methylphenyl)methylsulfanyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 71187230 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 3-hydroxy-5-[(4-methylphenyl)methylsulfanyl]-1H-pyridin-2-one |
| SMILES | Cc1ccc(CSc2c[nH]c(=O)c(O)c2)cc1 |
| InChI | InChI=1S/C13H13NO2S/c1-9-2-4-10(5-3-9)8-17-11-6-12(15)13(16)14-7-11/h2-7,15H,8H2,1H3,(H,14,16) |
| InChIKey | WSOOJEKUDGHUPJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |