C19H18N2 — CID 71187622
4-[(2S,3S)-2-methyl-3-phenyl-2,3-dihydro-1H-inden-5-yl]-1H-pyrazole (PubChem CID 71187622) has the molecular formula C19H18N2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 4-[(2S,3S)-2-methyl-3-phenyl-2,3-dihydro-1H-inden-5-yl]-1H-pyrazole.
| Compound Name | 4-[(2S,3S)-2-methyl-3-phenyl-2,3-dihydro-1H-inden-5-yl]-1H-pyrazole |
|---|---|
| PubChem CID | 71187622 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 4-[(2S,3S)-2-methyl-3-phenyl-2,3-dihydro-1H-inden-5-yl]-1H-pyrazole |
| SMILES | C[C@H]1Cc2ccc(-c3cn[nH]c3)cc2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H18N2/c1-13-9-16-8-7-15(17-11-20-21-12-17)10-18(16)19(13)14-5-3-2-4-6-14/h2-8,10-13,19H,9H2,1H3,(H,20,21)/t13-,19-/m0/s1 |
| InChIKey | GTFXZSGTZSFDNY-DJJJIMSYSA-N |
| XLogP | 4.40 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |