C8H12N2O5S2 — CID 71187665
(1S,5R)-2-(2-methylsulfanylacetyl)-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid (PubChem CID 71187665) has the molecular formula C8H12N2O5S2 and a molecular weight of 280.33 g/mol. Its IUPAC name is (1S,5R)-2-(2-methylsulfanylacetyl)-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid.
| Compound Name | (1S,5R)-2-(2-methylsulfanylacetyl)-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
|---|---|
| PubChem CID | 71187665 |
| Molecular Formula | C8H12N2O5S2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | (1S,5R)-2-(2-methylsulfanylacetyl)-7-oxo-2,6-diazabicyclo[3.2.0]heptane-6-sulfonic acid |
| SMILES | CSCC(=O)N1CC[C@@H]2[C@H]1C(=O)N2S(=O)(=O)O |
| InChI | InChI=1S/C8H12N2O5S2/c1-16-4-6(11)9-3-2-5-7(9)8(12)10(5)17(13,14)15/h5,7H,2-4H2,1H3,(H,13,14,15)/t5-,7+/m1/s1 |
| InChIKey | BAIIYDASYBFJCP-VDTYLAMSSA-N |
| XLogP | -1.04 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|