C19H31NO — CID 71187751
(Z)-4-(5,8a-dimethyl-2,3,4,4a-tetrahydro-1H-isoquinolin-4-yl)-2,3-dimethylhex-4-en-1-ol (PubChem CID 71187751) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is (Z)-4-(5,8a-dimethyl-2,3,4,4a-tetrahydro-1H-isoquinolin-4-yl)-2,3-dimethylhex-4-en-1-ol.
| Compound Name | (Z)-4-(5,8a-dimethyl-2,3,4,4a-tetrahydro-1H-isoquinolin-4-yl)-2,3-dimethylhex-4-en-1-ol |
|---|---|
| PubChem CID | 71187751 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | (Z)-4-(5,8a-dimethyl-2,3,4,4a-tetrahydro-1H-isoquinolin-4-yl)-2,3-dimethylhex-4-en-1-ol |
| SMILES | C/C=C(/C(C)C(C)CO)C1CNCC2(C)C=CC=C(C)C12 |
| InChI | InChI=1S/C19H31NO/c1-6-16(15(4)14(3)11-21)17-10-20-12-19(5)9-7-8-13(2)18(17)19/h6-9,14-15,17-18,20-21H,10-12H2,1-5H3/b16-6- |
| InChIKey | YWZOHYDLKSFNQY-SOFYXZRVSA-N |
| XLogP | 3.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|