C23H38O4 — CID 71187992
[(1R,2S,4R,5S)-4-acetyloxy-2-(4,6-dimethylhept-5-en-2-yl)-5-methylcyclohexyl] (Z)-2-methylbut-2-enoate (PubChem CID 71187992) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is [(1R,2S,4R,5S)-4-acetyloxy-2-(4,6-dimethylhept-5-en-2-yl)-5-methylcyclohexyl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,2S,4R,5S)-4-acetyloxy-2-(4,6-dimethylhept-5-en-2-yl)-5-methylcyclohexyl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 71187992 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | [(1R,2S,4R,5S)-4-acetyloxy-2-(4,6-dimethylhept-5-en-2-yl)-5-methylcyclohexyl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@@H]1C[C@H](C)[C@H](OC(C)=O)C[C@H]1C(C)CC(C)C=C(C)C |
| InChI | InChI=1S/C23H38O4/c1-9-16(5)23(25)27-22-12-18(7)21(26-19(8)24)13-20(22)17(6)11-15(4)10-14(2)3/h9-10,15,17-18,20-22H,11-13H2,1-8H3/b16-9-/t15?,17?,18-,20-,21+,22+/m0/s1 |
| InChIKey | RXABKRNFGYHZQG-OVPQWNAQSA-N |
| XLogP | 5.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|