C27H26F3N9O3 — CID 71188195
1-[4-[4-amino-7-(morpholin-4-ylmethyl)-6-(1,3-oxazol-5-yl)-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea (PubChem CID 71188195) has the molecular formula C27H26F3N9O3 and a molecular weight of 581.56 g/mol. Its IUPAC name is 1-[4-[4-amino-7-(morpholin-4-ylmethyl)-6-(1,3-oxazol-5-yl)-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea.
| Compound Name | 1-[4-[4-amino-7-(morpholin-4-ylmethyl)-6-(1,3-oxazol-5-yl)-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 71188195 |
| Molecular Formula | C27H26F3N9O3 |
| Molecular Weight | 581.56 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | 1-[4-[4-amino-7-(morpholin-4-ylmethyl)-6-(1,3-oxazol-5-yl)-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea |
| SMILES | NC1=NC=NN2C(CN3CCOCC3)=C(c3cnco3)C(c3ccc(NC(=O)Nc4cc(C(F)(F)F)ccn4)cc3)C12 |
| InChI | InChI=1S/C27H26F3N9O3/c28-27(29,30)17-5-6-33-21(11-17)37-26(40)36-18-3-1-16(2-4-18)22-23(20-12-32-15-42-20)19(13-38-7-9-41-10-8-38)39-24(22)25(31)34-14-35-39/h1-6,11-12,14-15,22,24H,7-10,13H2,(H2,31,34,35)(H2,33,36,37,40) |
| InChIKey | RFDPFLJJXMMORY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 146.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |