About (2E,3Z)-3-[(2,4-dimethylcyclobutyl)methylidene]-2-ethylidene-1-propan-2-ylpyrrole
(2E,3Z)-3-[(2,4-dimethylcyclobutyl)methylidene]-2-ethylidene-1-propan-2-ylpyrrole (PubChem CID 71188366) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is (2E,3Z)-3-[(2,4-dimethylcyclobutyl)methylidene]-2-ethylidene-1-propan-2-ylpyrrole.
Molecular Properties
| Compound Name | (2E,3Z)-3-[(2,4-dimethylcyclobutyl)methylidene]-2-ethylidene-1-propan-2-ylpyrrole |
| PubChem CID | 71188366 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (2E,3Z)-3-[(2,4-dimethylcyclobutyl)methylidene]-2-ethylidene-1-propan-2-ylpyrrole |
| SMILES | C/C=c1\c(=C/C2C(C)CC2C)ccn1C(C)C |
| InChI | InChI=1S/C16H25N/c1-6-16-14(7-8-17(16)11(2)3)10-15-12(4)9-13(15)5/h6-8,10-13,15H,9H2,1-5H3/b14-10-,16-6+ |
| InChIKey | GDENEAXCQCIAME-RRNXWBRGSA-N |
| XLogP | 2.94 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2E,3Z)-3-[(2,4-dimethylcyclobutyl)methylidene]-2-ethylidene-1-propan-2-ylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-3-[(2,4-dimethylcyclobutyl)methylidene]-2-ethylidene-1-propan-2-ylpyrrole?
The IUPAC name of (2E,3Z)-3-[(2,4-dimethylcyclobutyl)methylidene]-2-ethylidene-1-propan-2-ylpyrrole (CID 71188366) is (2E,3Z)-3-[(2,4-dimethylcyclobutyl)methylidene]-2-ethylidene-1-propan-2-ylpyrrole.
What is the SMILES notation for (2E,3Z)-3-[(2,4-dimethylcyclobutyl)methylidene]-2-ethylidene-1-propan-2-ylpyrrole?
The canonical SMILES for (2E,3Z)-3-[(2,4-dimethylcyclobutyl)methylidene]-2-ethylidene-1-propan-2-ylpyrrole is C/C=c1\c(=C/C2C(C)CC2C)ccn1C(C)C.
What is the InChIKey of (2E,3Z)-3-[(2,4-dimethylcyclobutyl)methylidene]-2-ethylidene-1-propan-2-ylpyrrole?
The InChIKey is GDENEAXCQCIAME-RRNXWBRGSA-N. The full InChI is InChI=1S/C16H25N/c1-6-16-14(7-8-17(16)11(2)3)10-15-12(4)9-13(15)5/h6-8,10-13,15H,9H2,1-5H3/b14-10-,16-6+.
What are the key properties of (2E,3Z)-3-[(2,4-dimethylcyclobutyl)methylidene]-2-ethylidene-1-propan-2-ylpyrrole?
(2E,3Z)-3-[(2,4-dimethylcyclobutyl)methylidene]-2-ethylidene-1-propan-2-ylpyrrole has a molecular weight of 231.38 g/mol, XLogP of 2.94, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-3-[(2,4-dimethylcyclobutyl)methylidene]-2-ethylidene-1-propan-2-ylpyrrole is sourced from PubChem (CID 71188366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).