C18H20N2O4 — CID 71188407
3-methyl-5-(3-methylphenyl)-9-nitro-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol (PubChem CID 71188407) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-methyl-5-(3-methylphenyl)-9-nitro-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol.
| Compound Name | 3-methyl-5-(3-methylphenyl)-9-nitro-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol |
|---|---|
| PubChem CID | 71188407 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3-methyl-5-(3-methylphenyl)-9-nitro-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol |
| SMILES | Cc1cccc(C2CN(C)CCc3c2cc(O)c(O)c3[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H20N2O4/c1-11-4-3-5-12(8-11)15-10-19(2)7-6-13-14(15)9-16(21)18(22)17(13)20(23)24/h3-5,8-9,15,21-22H,6-7,10H2,1-2H3 |
| InChIKey | KLVISBNKZOUTKU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|