About [4-(3-methylcyclohexa-1,5-dien-1-yl)oxypiperidin-1-yl]phosphane
[4-(3-methylcyclohexa-1,5-dien-1-yl)oxypiperidin-1-yl]phosphane (PubChem CID 71188425) has the molecular formula C12H20NOP
and a molecular weight of 225.27 g/mol. Its IUPAC name is [4-(3-methylcyclohexa-1,5-dien-1-yl)oxypiperidin-1-yl]phosphane.
Molecular Properties
| Compound Name | [4-(3-methylcyclohexa-1,5-dien-1-yl)oxypiperidin-1-yl]phosphane |
| PubChem CID | 71188425 |
| Molecular Formula | C12H20NOP |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | [4-(3-methylcyclohexa-1,5-dien-1-yl)oxypiperidin-1-yl]phosphane |
| SMILES | CC1C=C(OC2CCN(P)CC2)C=CC1 |
| InChI | InChI=1S/C12H20NOP/c1-10-3-2-4-12(9-10)14-11-5-7-13(15)8-6-11/h2,4,9-11H,3,5-8,15H2,1H3 |
| InChIKey | HRNKICDGIRFBMP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-methylcyclohexa-1,5-dien-1-yl)oxypiperidin-1-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-methylcyclohexa-1,5-dien-1-yl)oxypiperidin-1-yl]phosphane?
The IUPAC name of [4-(3-methylcyclohexa-1,5-dien-1-yl)oxypiperidin-1-yl]phosphane (CID 71188425) is [4-(3-methylcyclohexa-1,5-dien-1-yl)oxypiperidin-1-yl]phosphane.
What is the SMILES notation for [4-(3-methylcyclohexa-1,5-dien-1-yl)oxypiperidin-1-yl]phosphane?
The canonical SMILES for [4-(3-methylcyclohexa-1,5-dien-1-yl)oxypiperidin-1-yl]phosphane is CC1C=C(OC2CCN(P)CC2)C=CC1.
What is the InChIKey of [4-(3-methylcyclohexa-1,5-dien-1-yl)oxypiperidin-1-yl]phosphane?
The InChIKey is HRNKICDGIRFBMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20NOP/c1-10-3-2-4-12(9-10)14-11-5-7-13(15)8-6-11/h2,4,9-11H,3,5-8,15H2,1H3.
What are the key properties of [4-(3-methylcyclohexa-1,5-dien-1-yl)oxypiperidin-1-yl]phosphane?
[4-(3-methylcyclohexa-1,5-dien-1-yl)oxypiperidin-1-yl]phosphane has a molecular weight of 225.27 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-methylcyclohexa-1,5-dien-1-yl)oxypiperidin-1-yl]phosphane is sourced from PubChem (CID 71188425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).