C20H30S — CID 71188448
2,3,4,5,6,7-hexaethyl-1-benzothiophene (PubChem CID 71188448) has the molecular formula C20H30S and a molecular weight of 302.53 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexaethyl-1-benzothiophene.
| Compound Name | 2,3,4,5,6,7-hexaethyl-1-benzothiophene |
|---|---|
| PubChem CID | 71188448 |
| Molecular Formula | C20H30S |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2,3,4,5,6,7-hexaethyl-1-benzothiophene |
| SMILES | CCc1sc2c(CC)c(CC)c(CC)c(CC)c2c1CC |
| InChI | InChI=1S/C20H30S/c1-7-13-14(8-2)16(10-4)20-19(15(13)9-3)17(11-5)18(12-6)21-20/h7-12H2,1-6H3 |
| InChIKey | ZCCQVKKOKFLJJY-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |