C45H48N2 — CID 71188856
6-methyl-N-[1-[2-[[4-[6-(4-methylcyclohexa-1,3-dien-1-yl)-3a,4-dihydropyren-1-yl]cyclohexa-1,3-dien-1-yl]methylideneamino]cyclohexa-1,5-dien-1-yl]ethyl]cyclohex-2-en-1-amine (PubChem CID 71188856) has the molecular formula C45H48N2 and a molecular weight of 616.89 g/mol. Its IUPAC name is 6-methyl-N-[1-[2-[[4-[6-(4-methylcyclohexa-1,3-dien-1-yl)-3a,4-dihydropyren-1-yl]cyclohexa-1,3-dien-1-yl]methylideneamino]cyclohexa-1,5-dien-1-yl]ethyl]cyclohex-2-en-1-amine.
| Compound Name | 6-methyl-N-[1-[2-[[4-[6-(4-methylcyclohexa-1,3-dien-1-yl)-3a,4-dihydropyren-1-yl]cyclohexa-1,3-dien-1-yl]methylideneamino]cyclohexa-1,5-dien-1-yl]ethyl]cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 71188856 |
| Molecular Formula | C45H48N2 |
| Molecular Weight | 616.89 g/mol |
| Exact Mass | 616.38 |
| IUPAC Name | 6-methyl-N-[1-[2-[[4-[6-(4-methylcyclohexa-1,3-dien-1-yl)-3a,4-dihydropyren-1-yl]cyclohexa-1,3-dien-1-yl]methylideneamino]cyclohexa-1,5-dien-1-yl]ethyl]cyclohex-2-en-1-amine |
| SMILES | CC1=CC=C(c2ccc3ccc4c5c3c2=CCC5C=CC=4C2=CC=C(/C=N/C3=C(C(C)NC4C=CCCC4C)C=CCC3)CC2)CC1 |
| InChI | InChI=1S/C45H48N2/c1-29-12-16-33(17-13-29)38-24-20-35-23-27-41-39(25-21-36-22-26-40(38)44(35)45(36)41)34-18-14-32(15-19-34)28-46-43-11-7-5-9-37(43)31(3)47-42-10-6-4-8-30(42)2/h5-6,9-10,12,14,16,18,20-21,23-28,30-31,36,42,47H,4,7-8,11,13,15,17,19,22H2,1-3H3/b46-28+ |
| InChIKey | XLCSFAQNRIUEPD-HOKWUGLCSA-N |
| XLogP | 9.61 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.89 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|