C38H42N2 — CID 71188879
3-cyclohexa-1,3-dien-1-yl-2-[6-(10-methyl-2,3,5,6-tetrahydroanthracen-9-yl)-1,4,4a,7,8,8a-hexahydronaphthalen-2-yl]-1,2,6,7-tetrahydrobenzimidazole (PubChem CID 71188879) has the molecular formula C38H42N2 and a molecular weight of 526.77 g/mol. Its IUPAC name is 3-cyclohexa-1,3-dien-1-yl-2-[6-(10-methyl-2,3,5,6-tetrahydroanthracen-9-yl)-1,4,4a,7,8,8a-hexahydronaphthalen-2-yl]-1,2,6,7-tetrahydrobenzimidazole.
| Compound Name | 3-cyclohexa-1,3-dien-1-yl-2-[6-(10-methyl-2,3,5,6-tetrahydroanthracen-9-yl)-1,4,4a,7,8,8a-hexahydronaphthalen-2-yl]-1,2,6,7-tetrahydrobenzimidazole |
|---|---|
| PubChem CID | 71188879 |
| Molecular Formula | C38H42N2 |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | 3-cyclohexa-1,3-dien-1-yl-2-[6-(10-methyl-2,3,5,6-tetrahydroanthracen-9-yl)-1,4,4a,7,8,8a-hexahydronaphthalen-2-yl]-1,2,6,7-tetrahydrobenzimidazole |
| SMILES | Cc1c2c(c(C3=CC4CC=C(C5NC6=C(C=CCC6)N5C5=CC=CCC5)CC4CC3)c3c1=CCCC=3)C=CCC2 |
| InChI | InChI=1S/C38H42N2/c1-25-31-13-5-7-15-33(31)37(34-16-8-6-14-32(25)34)28-21-19-27-24-29(22-20-26(27)23-28)38-39-35-17-9-10-18-36(35)40(38)30-11-3-2-4-12-30/h2-3,7,10-11,14-16,18,22-23,26-27,38-39H,4-6,8-9,12-13,17,19-21,24H2,1H3 |
| InChIKey | WCGACXBJMHCSCO-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|