C39H39N — CID 71188891
N-cyclohexa-1,5-dien-1-yl-N-cyclohexa-2,4-dien-1-yl-4-[10-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydroanthracen-9-yl]cyclohexa-1,3-dien-1-amine (PubChem CID 71188891) has the molecular formula C39H39N and a molecular weight of 521.75 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-N-cyclohexa-2,4-dien-1-yl-4-[10-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydroanthracen-9-yl]cyclohexa-1,3-dien-1-amine.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-N-cyclohexa-2,4-dien-1-yl-4-[10-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydroanthracen-9-yl]cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 71188891 |
| Molecular Formula | C39H39N |
| Molecular Weight | 521.75 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-N-cyclohexa-2,4-dien-1-yl-4-[10-(4-methylcyclohexa-1,3-dien-1-yl)-2,3-dihydroanthracen-9-yl]cyclohexa-1,3-dien-1-amine |
| SMILES | CC1=CC=C(c2c3c(c(C4=CC=C(N(C5=CCCC=C5)C5C=CC=CC5)CC4)c4ccccc24)=CCCC=3)CC1 |
| InChI | InChI=1S/C39H39N/c1-28-20-22-29(23-21-28)38-34-16-8-10-18-36(34)39(37-19-11-9-17-35(37)38)30-24-26-33(27-25-30)40(31-12-4-2-5-13-31)32-14-6-3-7-15-32/h2,4-6,8,10,12,14-20,22,24,26,31H,3,7,9,11,13,21,23,25,27H2,1H3 |
| InChIKey | LSJCAVJWDFHRMO-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.75 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |