About trimethyl-[3-(trimethyl-λ4-sulfanyl)-1-adamantyl]-λ4-sulfane
trimethyl-[3-(trimethyl-λ4-sulfanyl)-1-adamantyl]-λ4-sulfane (PubChem CID 71189066) has the molecular formula C16H32S2
and a molecular weight of 288.57 g/mol. Its IUPAC name is trimethyl-[3-(trimethyl-λ4-sulfanyl)-1-adamantyl]-λ4-sulfane.
Molecular Properties
| Compound Name | trimethyl-[3-(trimethyl-λ4-sulfanyl)-1-adamantyl]-λ4-sulfane |
| PubChem CID | 71189066 |
| Molecular Formula | C16H32S2 |
| Molecular Weight | 288.57 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | trimethyl-[3-(trimethyl-λ4-sulfanyl)-1-adamantyl]-λ4-sulfane |
| SMILES | CS(C)(C)C12CC3CC(C1)CC(S(C)(C)C)(C3)C2 |
| InChI | InChI=1S/C16H32S2/c1-17(2,3)15-8-13-7-14(9-15)11-16(10-13,12-15)18(4,5)6/h13-14H,7-12H2,1-6H3 |
| InChIKey | VKVMGCWPVMIHFA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze trimethyl-[3-(trimethyl-λ4-sulfanyl)-1-adamantyl]-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[3-(trimethyl-λ4-sulfanyl)-1-adamantyl]-λ4-sulfane?
The IUPAC name of trimethyl-[3-(trimethyl-λ4-sulfanyl)-1-adamantyl]-λ4-sulfane (CID 71189066) is trimethyl-[3-(trimethyl-λ4-sulfanyl)-1-adamantyl]-λ4-sulfane.
What is the SMILES notation for trimethyl-[3-(trimethyl-λ4-sulfanyl)-1-adamantyl]-λ4-sulfane?
The canonical SMILES for trimethyl-[3-(trimethyl-λ4-sulfanyl)-1-adamantyl]-λ4-sulfane is CS(C)(C)C12CC3CC(C1)CC(S(C)(C)C)(C3)C2.
What is the InChIKey of trimethyl-[3-(trimethyl-λ4-sulfanyl)-1-adamantyl]-λ4-sulfane?
The InChIKey is VKVMGCWPVMIHFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32S2/c1-17(2,3)15-8-13-7-14(9-15)11-16(10-13,12-15)18(4,5)6/h13-14H,7-12H2,1-6H3.
What are the key properties of trimethyl-[3-(trimethyl-λ4-sulfanyl)-1-adamantyl]-λ4-sulfane?
trimethyl-[3-(trimethyl-λ4-sulfanyl)-1-adamantyl]-λ4-sulfane has a molecular weight of 288.57 g/mol, XLogP of 4.47, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[3-(trimethyl-λ4-sulfanyl)-1-adamantyl]-λ4-sulfane is sourced from PubChem (CID 71189066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).