C25H52O6Si — CID 71189081
[(2S,3S,4S,5R,6R)-3,4,5-tributoxy-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxan-2-yl]methanol (PubChem CID 71189081) has the molecular formula C25H52O6Si and a molecular weight of 476.77 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-3,4,5-tributoxy-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxan-2-yl]methanol.
| Compound Name | [(2S,3S,4S,5R,6R)-3,4,5-tributoxy-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxan-2-yl]methanol |
|---|---|
| PubChem CID | 71189081 |
| Molecular Formula | C25H52O6Si |
| Molecular Weight | 476.77 g/mol |
| Exact Mass | 476.35 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-3,4,5-tributoxy-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]oxan-2-yl]methanol |
| SMILES | CCCCO[C@@H]1[C@@H](OCCCC)[C@H](CO)O[C@H](CCC(C)(C)[Si](C)(C)O)[C@H]1OCCCC |
| InChI | InChI=1S/C25H52O6Si/c1-8-11-16-28-22-20(14-15-25(4,5)32(6,7)27)31-21(19-26)23(29-17-12-9-2)24(22)30-18-13-10-3/h20-24,26-27H,8-19H2,1-7H3/t20-,21+,22-,23+,24+/m1/s1 |
| InChIKey | CWAZUJSDDMHPAV-KNOCVWDGSA-N |
| XLogP | 5.06 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.77 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|