C24H35N3O — CID 71189214
N-[(7S)-1,7-dimethyl-7-bicyclo[2.2.1]heptanyl]-5-pentyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 71189214) has the molecular formula C24H35N3O and a molecular weight of 381.56 g/mol. Its IUPAC name is N-[(7S)-1,7-dimethyl-7-bicyclo[2.2.1]heptanyl]-5-pentyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | N-[(7S)-1,7-dimethyl-7-bicyclo[2.2.1]heptanyl]-5-pentyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 71189214 |
| Molecular Formula | C24H35N3O |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | N-[(7S)-1,7-dimethyl-7-bicyclo[2.2.1]heptanyl]-5-pentyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | CCCCCC1=NN(C(=O)N[C@@]2(C)C3CCC2(C)CC3)CC1c1ccccc1 |
| InChI | InChI=1S/C24H35N3O/c1-4-5-7-12-21-20(18-10-8-6-9-11-18)17-27(26-21)22(28)25-24(3)19-13-15-23(24,2)16-14-19/h6,8-11,19-20H,4-5,7,12-17H2,1-3H3,(H,25,28)/t19?,20?,23?,24-/m0/s1 |
| InChIKey | SWHYKLGDIHJLRU-RRTRMPBKSA-N |
| XLogP | 5.70 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|