C23H29NO8 — CID 71189721
2-[2-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxoethoxy]acetic acid (PubChem CID 71189721) has the molecular formula C23H29NO8 and a molecular weight of 447.48 g/mol. Its IUPAC name is 2-[2-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 71189721 |
| Molecular Formula | C23H29NO8 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 2-[2-[[(4R,4aS,7aR,12bS)-4a-hydroxy-9-methoxy-3,4,12-trimethyl-2,4,5,7a-tetrahydro-1H-[1]benzofuro[3,2-e]isoquinolin-7-yl]oxy]-2-oxoethoxy]acetic acid |
| SMILES | COc1ccc(C)c2c1O[C@H]1C(OC(=O)COCC(=O)O)=CC[C@@]3(O)[C@@H](C)N(C)CC[C@]213 |
| InChI | InChI=1S/C23H29NO8/c1-13-5-6-15(29-4)20-19(13)22-9-10-24(3)14(2)23(22,28)8-7-16(21(22)32-20)31-18(27)12-30-11-17(25)26/h5-7,14,21,28H,8-12H2,1-4H3,(H,25,26)/t14-,21+,22+,23-/m1/s1 |
| InChIKey | VGRSTDJTAORPQW-VOAOOXFISA-N |
| XLogP | 1.39 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |