C18H24O2 — CID 71189932
5-(2-ethyl-4-oxocyclohex-2-en-1-yl)-7a-methyl-3,3a,4,7-tetrahydro-2H-inden-1-one (PubChem CID 71189932) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 5-(2-ethyl-4-oxocyclohex-2-en-1-yl)-7a-methyl-3,3a,4,7-tetrahydro-2H-inden-1-one.
| Compound Name | 5-(2-ethyl-4-oxocyclohex-2-en-1-yl)-7a-methyl-3,3a,4,7-tetrahydro-2H-inden-1-one |
|---|---|
| PubChem CID | 71189932 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 5-(2-ethyl-4-oxocyclohex-2-en-1-yl)-7a-methyl-3,3a,4,7-tetrahydro-2H-inden-1-one |
| SMILES | CCC1=CC(=O)CCC1C1=CCC2(C)C(=O)CCC2C1 |
| InChI | InChI=1S/C18H24O2/c1-3-12-11-15(19)5-6-16(12)13-8-9-18(2)14(10-13)4-7-17(18)20/h8,11,14,16H,3-7,9-10H2,1-2H3 |
| InChIKey | RSRRIRGUFAVOGH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|