About 2-methoxynaphthalene
2-methoxynaphthalene (PubChem CID 7119) has the molecular formula C11H10O
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-methoxynaphthalene.
Molecular Properties
| Compound Name | 2-methoxynaphthalene |
| PubChem CID | 7119 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 2-methoxynaphthalene |
| SMILES | COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H10O/c1-12-11-7-6-9-4-2-3-5-10(9)8-11/h2-8H,1H3 |
| InChIKey | LUZDYPLAQQGJEA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methoxynaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxynaphthalene?
The IUPAC name of 2-methoxynaphthalene (CID 7119) is 2-methoxynaphthalene.
What is the SMILES notation for 2-methoxynaphthalene?
The canonical SMILES for 2-methoxynaphthalene is COc1ccc2ccccc2c1.
What is the InChIKey of 2-methoxynaphthalene?
The InChIKey is LUZDYPLAQQGJEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O/c1-12-11-7-6-9-4-2-3-5-10(9)8-11/h2-8H,1H3.
What are the key properties of 2-methoxynaphthalene?
2-methoxynaphthalene has a molecular weight of 158.20 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxynaphthalene is sourced from PubChem (CID 7119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).