C24H48N4O — CID 71190362
N-(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)-3-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]propanamide (PubChem CID 71190362) has the molecular formula C24H48N4O and a molecular weight of 408.68 g/mol. Its IUPAC name is N-(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)-3-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]propanamide.
| Compound Name | N-(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)-3-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 71190362 |
| Molecular Formula | C24H48N4O |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 408.38 |
| IUPAC Name | N-(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl)-3-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]propanamide |
| SMILES | CCN1C(C)(C)CC(NC(=O)CCNC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C24H48N4O/c1-11-28-23(6,7)16-19(17-24(28,8)9)26-20(29)12-13-25-18-14-21(2,3)27(10)22(4,5)15-18/h18-19,25H,11-17H2,1-10H3,(H,26,29) |
| InChIKey | ORFSLKIMAMBUOH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |