C29H42N2O2 — CID 71190653
4-benzyl-N-[(3-methyl-4-pentylphenyl)methyl]-N-(2-methylpropyl)morpholine-2-carboxamide (PubChem CID 71190653) has the molecular formula C29H42N2O2 and a molecular weight of 450.67 g/mol. Its IUPAC name is 4-benzyl-N-[(3-methyl-4-pentylphenyl)methyl]-N-(2-methylpropyl)morpholine-2-carboxamide.
| Compound Name | 4-benzyl-N-[(3-methyl-4-pentylphenyl)methyl]-N-(2-methylpropyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 71190653 |
| Molecular Formula | C29H42N2O2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | 4-benzyl-N-[(3-methyl-4-pentylphenyl)methyl]-N-(2-methylpropyl)morpholine-2-carboxamide |
| SMILES | CCCCCc1ccc(CN(CC(C)C)C(=O)C2CN(Cc3ccccc3)CCO2)cc1C |
| InChI | InChI=1S/C29H42N2O2/c1-5-6-8-13-27-15-14-26(18-24(27)4)21-31(19-23(2)3)29(32)28-22-30(16-17-33-28)20-25-11-9-7-10-12-25/h7,9-12,14-15,18,23,28H,5-6,8,13,16-17,19-22H2,1-4H3 |
| InChIKey | VPHUATXADLCAHZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|