C24H25ClFN7O3S — CID 71190769
1-[4-[4-amino-7-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]-2-fluorophenyl]-3-(3-chlorophenyl)urea (PubChem CID 71190769) has the molecular formula C24H25ClFN7O3S and a molecular weight of 546.03 g/mol. Its IUPAC name is 1-[4-[4-amino-7-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]-2-fluorophenyl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[4-[4-amino-7-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]-2-fluorophenyl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 71190769 |
| Molecular Formula | C24H25ClFN7O3S |
| Molecular Weight | 546.03 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | 1-[4-[4-amino-7-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]-2-fluorophenyl]-3-(3-chlorophenyl)urea |
| SMILES | NC1=NC=NN2C(CN3CCS(=O)(=O)CC3)=CC(c3ccc(NC(=O)Nc4cccc(Cl)c4)c(F)c3)C12 |
| InChI | InChI=1S/C24H25ClFN7O3S/c25-16-2-1-3-17(11-16)30-24(34)31-21-5-4-15(10-20(21)26)19-12-18(33-22(19)23(27)28-14-29-33)13-32-6-8-37(35,36)9-7-32/h1-5,10-12,14,19,22H,6-9,13H2,(H2,27,28,29)(H2,30,31,34) |
| InChIKey | DUYGWTUHKAHLAX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 132.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.03 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |