About 4-(2-methoxyphenyl)-5,6-dihydrobenzo[h]quinoline-2,3-diamine
4-(2-methoxyphenyl)-5,6-dihydrobenzo[h]quinoline-2,3-diamine (PubChem CID 71191881) has the molecular formula C20H19N3O
and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-5,6-dihydrobenzo[h]quinoline-2,3-diamine.
Molecular Properties
| Compound Name | 4-(2-methoxyphenyl)-5,6-dihydrobenzo[h]quinoline-2,3-diamine |
| PubChem CID | 71191881 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 4-(2-methoxyphenyl)-5,6-dihydrobenzo[h]quinoline-2,3-diamine |
| SMILES | COc1ccccc1-c1c(N)c(N)nc2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C20H19N3O/c1-24-16-9-5-4-8-14(16)17-15-11-10-12-6-2-3-7-13(12)19(15)23-20(22)18(17)21/h2-9H,10-11,21H2,1H3,(H2,22,23) |
| InChIKey | NNOXCAXXBQAMFB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-methoxyphenyl)-5,6-dihydrobenzo[h]quinoline-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxyphenyl)-5,6-dihydrobenzo[h]quinoline-2,3-diamine?
The IUPAC name of 4-(2-methoxyphenyl)-5,6-dihydrobenzo[h]quinoline-2,3-diamine (CID 71191881) is 4-(2-methoxyphenyl)-5,6-dihydrobenzo[h]quinoline-2,3-diamine.
What is the SMILES notation for 4-(2-methoxyphenyl)-5,6-dihydrobenzo[h]quinoline-2,3-diamine?
The canonical SMILES for 4-(2-methoxyphenyl)-5,6-dihydrobenzo[h]quinoline-2,3-diamine is COc1ccccc1-c1c(N)c(N)nc2c1CCc1ccccc1-2.
What is the InChIKey of 4-(2-methoxyphenyl)-5,6-dihydrobenzo[h]quinoline-2,3-diamine?
The InChIKey is NNOXCAXXBQAMFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O/c1-24-16-9-5-4-8-14(16)17-15-11-10-12-6-2-3-7-13(12)19(15)23-20(22)18(17)21/h2-9H,10-11,21H2,1H3,(H2,22,23).
What are the key properties of 4-(2-methoxyphenyl)-5,6-dihydrobenzo[h]quinoline-2,3-diamine?
4-(2-methoxyphenyl)-5,6-dihydrobenzo[h]quinoline-2,3-diamine has a molecular weight of 317.39 g/mol, XLogP of 3.69, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxyphenyl)-5,6-dihydrobenzo[h]quinoline-2,3-diamine is sourced from PubChem (CID 71191881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).