C27H31N3O6 — CID 71192001
tert-butyl (2S)-3-[4-[(7aS)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]phenyl]-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 71192001) has the molecular formula C27H31N3O6 and a molecular weight of 493.56 g/mol. Its IUPAC name is tert-butyl (2S)-3-[4-[(7aS)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]phenyl]-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | tert-butyl (2S)-3-[4-[(7aS)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]phenyl]-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 71192001 |
| Molecular Formula | C27H31N3O6 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | tert-butyl (2S)-3-[4-[(7aS)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]phenyl]-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](Cc1ccc(N2C(=O)[C@@H]3CCCN3C2=O)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H31N3O6/c1-27(2,3)36-24(32)21(28-25(33)35-17-19-8-5-4-6-9-19)16-18-11-13-20(14-12-18)30-23(31)22-10-7-15-29(22)26(30)34/h4-6,8-9,11-14,21-22H,7,10,15-17H2,1-3H3,(H,28,33)/t21-,22-/m0/s1 |
| InChIKey | PNBJEUPGWCOSMW-VXKWHMMOSA-N |
| XLogP | 3.80 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|