C22H20N2O2 — CID 71192052
2-(4-methoxyphenyl)-6-methyl-8-phenylmethoxyimidazo[1,2-a]pyridine (PubChem CID 71192052) has the molecular formula C22H20N2O2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6-methyl-8-phenylmethoxyimidazo[1,2-a]pyridine.
| Compound Name | 2-(4-methoxyphenyl)-6-methyl-8-phenylmethoxyimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 71192052 |
| Molecular Formula | C22H20N2O2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-(4-methoxyphenyl)-6-methyl-8-phenylmethoxyimidazo[1,2-a]pyridine |
| SMILES | COc1ccc(-c2cn3cc(C)cc(OCc4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C22H20N2O2/c1-16-12-21(26-15-17-6-4-3-5-7-17)22-23-20(14-24(22)13-16)18-8-10-19(25-2)11-9-18/h3-14H,15H2,1-2H3 |
| InChIKey | RORYZRHRXPFWMM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |