C47H59BN3O9S — CID 71192201
CID 71192201 (PubChem CID 71192201) has the molecular formula C47H59BN3O9S and a molecular weight of 852.88 g/mol.
| Compound Name | CID 71192201 |
|---|---|
| PubChem CID | 71192201 |
| Molecular Formula | C47H59BN3O9S |
| Molecular Weight | 852.88 g/mol |
| Exact Mass | 852.41 |
| IUPAC Name | — |
| SMILES | CCC1=C[C@H]2CN(C1)CC1=C([B]c3ccc(SCCO)cc31)[C@@](C(=O)OC)(C1C=C3C(=CC1OC)N(C)[C@H]1[C@@](O)(C(=O)OC)[C@H](OC(C)=O)[C@]4(CC)C=CCN5CC[C@]31[C@@H]54)C2 |
| InChI | InChI=1S/C47H59BN3O9S/c1-8-28-19-29-23-46(42(54)58-6,38-32(26-50(24-28)25-29)31-20-30(61-18-17-52)11-12-35(31)48-38)34-21-33-36(22-37(34)57-5)49(4)40-45(33)14-16-51-15-10-13-44(9-2,39(45)51)41(60-27(3)53)47(40,56)43(55)59-7/h10-13,19-22,29,34,37,39-41,52,56H,8-9,14-18,23-26H2,1-7H3/t29-,34?,37?,39+,40-,41-,44-,45-,46+,47+/m1/s1 |
| InChIKey | FXIMVMLCIZIVAC-ZUYODGOYSA-N |
| XLogP | 3.30 |
| TPSA | 138.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.88 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|